C17H30N4O8 — CID 142768231
2-[(8Z)-4,7-bis(carboxymethyl)-10-(2,3-dihydroxypropyl)-1,4,7,10-tetrazacyclododec-8-en-1-yl]acetic acid (PubChem CID 142768231) has the molecular formula C17H30N4O8 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-[(8Z)-4,7-bis(carboxymethyl)-10-(2,3-dihydroxypropyl)-1,4,7,10-tetrazacyclododec-8-en-1-yl]acetic acid.
| Compound Name | 2-[(8Z)-4,7-bis(carboxymethyl)-10-(2,3-dihydroxypropyl)-1,4,7,10-tetrazacyclododec-8-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 142768231 |
| Molecular Formula | C17H30N4O8 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 2-[(8Z)-4,7-bis(carboxymethyl)-10-(2,3-dihydroxypropyl)-1,4,7,10-tetrazacyclododec-8-en-1-yl]acetic acid |
| SMILES | O=C(O)CN1/C=C\N(CC(O)CO)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C17H30N4O8/c22-13-14(23)9-18-1-3-19(10-15(24)25)5-7-21(12-17(28)29)8-6-20(4-2-18)11-16(26)27/h1,3,14,22-23H,2,4-13H2,(H,24,25)(H,26,27)(H,28,29)/b3-1- |
| InChIKey | MBQDUWALDKRGNY-IWQZZHSRSA-N |
| XLogP | -2.71 |
| TPSA | 165.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |