C14H28N4O6 — CID 123412300
2-[4-(carboxymethyl)-7-[2-hydroxy-2-(2-hydroxyethylamino)ethyl]-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 123412300) has the molecular formula C14H28N4O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-7-[2-hydroxy-2-(2-hydroxyethylamino)ethyl]-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-(carboxymethyl)-7-[2-hydroxy-2-(2-hydroxyethylamino)ethyl]-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 123412300 |
| Molecular Formula | C14H28N4O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[4-(carboxymethyl)-7-[2-hydroxy-2-(2-hydroxyethylamino)ethyl]-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(O)NCCO)CC1 |
| InChI | InChI=1S/C14H28N4O6/c19-8-1-15-12(20)9-16-2-4-17(10-13(21)22)6-7-18(5-3-16)11-14(23)24/h12,15,19-20H,1-11H2,(H,21,22)(H,23,24) |
| InChIKey | YZTKPJCMYBDDKA-UHFFFAOYSA-N |
| XLogP | -3.02 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|