C10H13NO5 — CID 82056097
2-[3-(3-hydroxypropoxy)-2-oxo-1-pyridinyl]acetic acid (PubChem CID 82056097) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-[3-(3-hydroxypropoxy)-2-oxo-1-pyridinyl]acetic acid.
| Compound Name | 2-[3-(3-hydroxypropoxy)-2-oxo-1-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 82056097 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-[3-(3-hydroxypropoxy)-2-oxo-1-pyridinyl]acetic acid |
| SMILES | O=C(O)Cn1cccc(OCCCO)c1=O |
| InChI | InChI=1S/C10H13NO5/c12-5-2-6-16-8-3-1-4-11(10(8)15)7-9(13)14/h1,3-4,12H,2,5-7H2,(H,13,14) |
| InChIKey | LQRZZQSVQQMHAT-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|