C12H15N3O — CID 59559503
3-piperidin-4-yl-1,7-dihydropyrrolo[2,3-b]pyridin-6-one (PubChem CID 59559503) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-piperidin-4-yl-1,7-dihydropyrrolo[2,3-b]pyridin-6-one.
| Compound Name | 3-piperidin-4-yl-1,7-dihydropyrrolo[2,3-b]pyridin-6-one |
|---|---|
| PubChem CID | 59559503 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 3-piperidin-4-yl-1,7-dihydropyrrolo[2,3-b]pyridin-6-one |
| SMILES | O=c1ccc2c(C3CCNCC3)c[nH]c2[nH]1 |
| InChI | InChI=1S/C12H15N3O/c16-11-2-1-9-10(7-14-12(9)15-11)8-3-5-13-6-4-8/h1-2,7-8,13H,3-6H2,(H2,14,15,16) |
| InChIKey | CIYSYJWDAGKZEJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |