C12H15N3O — CID 96610524
2-piperidin-4-yl-1,5-dihydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 96610524) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-piperidin-4-yl-1,5-dihydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-piperidin-4-yl-1,5-dihydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 96610524 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-piperidin-4-yl-1,5-dihydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | O=c1[nH]ccc2[nH]c(C3CCNCC3)cc12 |
| InChI | InChI=1S/C12H15N3O/c16-12-9-7-11(8-1-4-13-5-2-8)15-10(9)3-6-14-12/h3,6-8,13,15H,1-2,4-5H2,(H,14,16) |
| InChIKey | MWJGUYXFIKKFOW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |