C35H39Cl2N5O4 — CID 59559802
methyl N-[4-[5-chloro-2-[(1S)-1-[3-[5-chloro-2-[(hexanoylamino)methyl]phenyl]propanoylamino]-2-phenylethyl]-1H-imidazol-4-yl]phenyl]carbamate (PubChem CID 59559802) has the molecular formula C35H39Cl2N5O4 and a molecular weight of 664.63 g/mol. Its IUPAC name is methyl N-[4-[5-chloro-2-[(1S)-1-[3-[5-chloro-2-[(hexanoylamino)methyl]phenyl]propanoylamino]-2-phenylethyl]-1H-imidazol-4-yl]phenyl]carbamate.
| Compound Name | methyl N-[4-[5-chloro-2-[(1S)-1-[3-[5-chloro-2-[(hexanoylamino)methyl]phenyl]propanoylamino]-2-phenylethyl]-1H-imidazol-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 59559802 |
| Molecular Formula | C35H39Cl2N5O4 |
| Molecular Weight | 664.63 g/mol |
| Exact Mass | 663.24 |
| IUPAC Name | methyl N-[4-[5-chloro-2-[(1S)-1-[3-[5-chloro-2-[(hexanoylamino)methyl]phenyl]propanoylamino]-2-phenylethyl]-1H-imidazol-4-yl]phenyl]carbamate |
| SMILES | CCCCCC(=O)NCc1ccc(Cl)cc1CCC(=O)N[C@@H](Cc1ccccc1)c1nc(-c2ccc(NC(=O)OC)cc2)c(Cl)[nH]1 |
| InChI | InChI=1S/C35H39Cl2N5O4/c1-3-4-6-11-30(43)38-22-26-12-16-27(36)21-25(26)15-19-31(44)40-29(20-23-9-7-5-8-10-23)34-41-32(33(37)42-34)24-13-17-28(18-14-24)39-35(45)46-2/h5,7-10,12-14,16-18,21,29H,3-4,6,11,15,19-20,22H2,1-2H3,(H,38,43)(H,39,45)(H,40,44)(H,41,42)/t29-/m0/s1 |
| InChIKey | VWGDEWVMWXKUPL-LJAQVGFWSA-N |
| XLogP | 7.79 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.63 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|