C28H22Cl2F2N4O3 — CID 66938725
methyl N-[4-[5-chloro-2-[(1S)-1-[3-(3-chloro-2,6-difluorophenyl)prop-2-enoylamino]-2-phenylethyl]-1H-imidazol-4-yl]phenyl]carbamate (PubChem CID 66938725) has the molecular formula C28H22Cl2F2N4O3 and a molecular weight of 571.41 g/mol. Its IUPAC name is methyl N-[4-[5-chloro-2-[(1S)-1-[3-(3-chloro-2,6-difluorophenyl)prop-2-enoylamino]-2-phenylethyl]-1H-imidazol-4-yl]phenyl]carbamate.
| Compound Name | methyl N-[4-[5-chloro-2-[(1S)-1-[3-(3-chloro-2,6-difluorophenyl)prop-2-enoylamino]-2-phenylethyl]-1H-imidazol-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 66938725 |
| Molecular Formula | C28H22Cl2F2N4O3 |
| Molecular Weight | 571.41 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | methyl N-[4-[5-chloro-2-[(1S)-1-[3-(3-chloro-2,6-difluorophenyl)prop-2-enoylamino]-2-phenylethyl]-1H-imidazol-4-yl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(-c2nc([C@H](Cc3ccccc3)NC(=O)C=Cc3c(F)ccc(Cl)c3F)[nH]c2Cl)cc1 |
| InChI | InChI=1S/C28H22Cl2F2N4O3/c1-39-28(38)33-18-9-7-17(8-10-18)25-26(30)36-27(35-25)22(15-16-5-3-2-4-6-16)34-23(37)14-11-19-21(31)13-12-20(29)24(19)32/h2-14,22H,15H2,1H3,(H,33,38)(H,34,37)(H,35,36)/t22-/m0/s1 |
| InChIKey | GTTNBYWVSAOOOT-QFIPXVFZSA-N |
| XLogP | 6.95 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.41 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|