C34H49N3O4Si — CID 59563752
tert-butyl N-[3-(isoquinolin-6-ylamino)-3-oxo-2-[4-[tri(propan-2-yl)silyloxymethyl]phenyl]propyl]-N-methylcarbamate (PubChem CID 59563752) has the molecular formula C34H49N3O4Si and a molecular weight of 591.87 g/mol. Its IUPAC name is tert-butyl N-[3-(isoquinolin-6-ylamino)-3-oxo-2-[4-[tri(propan-2-yl)silyloxymethyl]phenyl]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-(isoquinolin-6-ylamino)-3-oxo-2-[4-[tri(propan-2-yl)silyloxymethyl]phenyl]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59563752 |
| Molecular Formula | C34H49N3O4Si |
| Molecular Weight | 591.87 g/mol |
| Exact Mass | 591.35 |
| IUPAC Name | tert-butyl N-[3-(isoquinolin-6-ylamino)-3-oxo-2-[4-[tri(propan-2-yl)silyloxymethyl]phenyl]propyl]-N-methylcarbamate |
| SMILES | CC(C)[Si](OCc1ccc(C(CN(C)C(=O)OC(C)(C)C)C(=O)Nc2ccc3cnccc3c2)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H49N3O4Si/c1-23(2)42(24(3)4,25(5)6)40-22-26-11-13-27(14-12-26)31(21-37(10)33(39)41-34(7,8)9)32(38)36-30-16-15-29-20-35-18-17-28(29)19-30/h11-20,23-25,31H,21-22H2,1-10H3,(H,36,38) |
| InChIKey | RZOKCYPDFBSOHY-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.87 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|