C23H26N2O3 — CID 159006594
[4-[(2S)-1-(isoquinolin-6-ylamino)-1-oxobutan-2-yl]phenyl]methyl acetate;methane (PubChem CID 159006594) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is [4-[(2S)-1-(isoquinolin-6-ylamino)-1-oxobutan-2-yl]phenyl]methyl acetate;methane.
| Compound Name | [4-[(2S)-1-(isoquinolin-6-ylamino)-1-oxobutan-2-yl]phenyl]methyl acetate;methane |
|---|---|
| PubChem CID | 159006594 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [4-[(2S)-1-(isoquinolin-6-ylamino)-1-oxobutan-2-yl]phenyl]methyl acetate;methane |
| SMILES | C.CCC(C(=O)Nc1ccc2cnccc2c1)c1ccc(COC(C)=O)cc1 |
| InChI | InChI=1S/C22H22N2O3.CH4/c1-3-21(17-6-4-16(5-7-17)14-27-15(2)25)22(26)24-20-9-8-19-13-23-11-10-18(19)12-20;/h4-13,21H,3,14H2,1-2H3,(H,24,26);1H4 |
| InChIKey | JRZMETAOPALSJB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |