C18H18BN3O3 — CID 155582908
[4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]boronic acid (PubChem CID 155582908) has the molecular formula C18H18BN3O3 and a molecular weight of 335.17 g/mol. Its IUPAC name is [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]boronic acid.
| Compound Name | [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 155582908 |
| Molecular Formula | C18H18BN3O3 |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]boronic acid |
| SMILES | NCC(C(=O)Nc1ccc2cnccc2c1)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C18H18BN3O3/c20-10-17(12-1-4-15(5-2-12)19(24)25)18(23)22-16-6-3-14-11-21-8-7-13(14)9-16/h1-9,11,17,24-25H,10,20H2,(H,22,23) |
| InChIKey | UTXFYQOYXIBPAU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|