C21H24BN3O3 — CID 174027234
3-[3-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]propylboronic acid (PubChem CID 174027234) has the molecular formula C21H24BN3O3 and a molecular weight of 377.25 g/mol. Its IUPAC name is 3-[3-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]propylboronic acid.
| Compound Name | 3-[3-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]propylboronic acid |
|---|---|
| PubChem CID | 174027234 |
| Molecular Formula | C21H24BN3O3 |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 3-[3-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]propylboronic acid |
| SMILES | NCC(C(=O)Nc1ccc2cnccc2c1)c1cccc(CCCB(O)O)c1 |
| InChI | InChI=1S/C21H24BN3O3/c23-13-20(17-5-1-3-15(11-17)4-2-9-22(27)28)21(26)25-19-7-6-18-14-24-10-8-16(18)12-19/h1,3,5-8,10-12,14,20,27-28H,2,4,9,13,23H2,(H,25,26) |
| InChIKey | CEYWGJBEXPPCGT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|