C20H22BN3O4 — CID 174027290
[4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]-2-(methoxymethyl)phenyl]boronic acid (PubChem CID 174027290) has the molecular formula C20H22BN3O4 and a molecular weight of 379.23 g/mol. Its IUPAC name is [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]-2-(methoxymethyl)phenyl]boronic acid.
| Compound Name | [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]-2-(methoxymethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 174027290 |
| Molecular Formula | C20H22BN3O4 |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]-2-(methoxymethyl)phenyl]boronic acid |
| SMILES | COCc1cc(C(CN)C(=O)Nc2ccc3cnccc3c2)ccc1B(O)O |
| InChI | InChI=1S/C20H22BN3O4/c1-28-12-16-8-14(3-5-19(16)21(26)27)18(10-22)20(25)24-17-4-2-15-11-23-7-6-13(15)9-17/h2-9,11,18,26-27H,10,12,22H2,1H3,(H,24,25) |
| InChIKey | MUUNORVHXTWPPF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|