C21H22IN3O — CID 155582967
3-amino-2-[3-ethyl-4-(methylidene-λ3-iodanyl)phenyl]-N-isoquinolin-6-ylpropanamide (PubChem CID 155582967) has the molecular formula C21H22IN3O and a molecular weight of 459.33 g/mol. Its IUPAC name is 3-amino-2-[3-ethyl-4-(methylidene-λ3-iodanyl)phenyl]-N-isoquinolin-6-ylpropanamide.
| Compound Name | 3-amino-2-[3-ethyl-4-(methylidene-λ3-iodanyl)phenyl]-N-isoquinolin-6-ylpropanamide |
|---|---|
| PubChem CID | 155582967 |
| Molecular Formula | C21H22IN3O |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 3-amino-2-[3-ethyl-4-(methylidene-λ3-iodanyl)phenyl]-N-isoquinolin-6-ylpropanamide |
| SMILES | C=Ic1ccc(C(CN)C(=O)Nc2ccc3cnccc3c2)cc1CC |
| InChI | InChI=1S/C21H22IN3O/c1-3-14-10-16(5-7-20(14)22-2)19(12-23)21(26)25-18-6-4-17-13-24-9-8-15(17)11-18/h4-11,13,19H,2-3,12,23H2,1H3,(H,25,26) |
| InChIKey | ZXLOKIPJOFALTO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|