C20H19BN4O3 — CID 174027469
3-amino-2-(1-hydroxy-3-methyl-2,4,1-benzoxazaborinin-7-yl)-N-isoquinolin-6-ylpropanamide (PubChem CID 174027469) has the molecular formula C20H19BN4O3 and a molecular weight of 374.21 g/mol. Its IUPAC name is 3-amino-2-(1-hydroxy-3-methyl-2,4,1-benzoxazaborinin-7-yl)-N-isoquinolin-6-ylpropanamide.
| Compound Name | 3-amino-2-(1-hydroxy-3-methyl-2,4,1-benzoxazaborinin-7-yl)-N-isoquinolin-6-ylpropanamide |
|---|---|
| PubChem CID | 174027469 |
| Molecular Formula | C20H19BN4O3 |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 3-amino-2-(1-hydroxy-3-methyl-2,4,1-benzoxazaborinin-7-yl)-N-isoquinolin-6-ylpropanamide |
| SMILES | CC1=Nc2ccc(C(CN)C(=O)Nc3ccc4cnccc4c3)cc2B(O)O1 |
| InChI | InChI=1S/C20H19BN4O3/c1-12-24-19-5-3-14(9-18(19)21(27)28-12)17(10-22)20(26)25-16-4-2-15-11-23-7-6-13(15)8-16/h2-9,11,17,27H,10,22H2,1H3,(H,25,26) |
| InChIKey | BXJBXJIQVXRZOZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|