C19H17BN4O4 — CID 174027464
3-amino-2-(1-hydroxy-4-oxo-2,3,1-benzoxazaborinin-7-yl)-N-isoquinolin-6-ylpropanamide (PubChem CID 174027464) has the molecular formula C19H17BN4O4 and a molecular weight of 376.18 g/mol. Its IUPAC name is 3-amino-2-(1-hydroxy-4-oxo-2,3,1-benzoxazaborinin-7-yl)-N-isoquinolin-6-ylpropanamide.
| Compound Name | 3-amino-2-(1-hydroxy-4-oxo-2,3,1-benzoxazaborinin-7-yl)-N-isoquinolin-6-ylpropanamide |
|---|---|
| PubChem CID | 174027464 |
| Molecular Formula | C19H17BN4O4 |
| Molecular Weight | 376.18 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 3-amino-2-(1-hydroxy-4-oxo-2,3,1-benzoxazaborinin-7-yl)-N-isoquinolin-6-ylpropanamide |
| SMILES | NCC(C(=O)Nc1ccc2cnccc2c1)c1ccc2c(c1)B(O)ONC2=O |
| InChI | InChI=1S/C19H17BN4O4/c21-9-16(12-2-4-15-17(8-12)20(27)28-24-19(15)26)18(25)23-14-3-1-13-10-22-6-5-11(13)7-14/h1-8,10,16,27H,9,21H2,(H,23,25)(H,24,26) |
| InChIKey | AYHBGSZSDBHXQV-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.18 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|