C19H18BN3O3 — CID 167688297
4-amino-3-(3-hydroxy-1H-2,1,3-benzoxazaborol-6-yl)-1-isoquinolin-6-ylbutan-2-one (PubChem CID 167688297) has the molecular formula C19H18BN3O3 and a molecular weight of 347.18 g/mol. Its IUPAC name is 4-amino-3-(3-hydroxy-1H-2,1,3-benzoxazaborol-6-yl)-1-isoquinolin-6-ylbutan-2-one.
| Compound Name | 4-amino-3-(3-hydroxy-1H-2,1,3-benzoxazaborol-6-yl)-1-isoquinolin-6-ylbutan-2-one |
|---|---|
| PubChem CID | 167688297 |
| Molecular Formula | C19H18BN3O3 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 4-amino-3-(3-hydroxy-1H-2,1,3-benzoxazaborol-6-yl)-1-isoquinolin-6-ylbutan-2-one |
| SMILES | NCC(C(=O)Cc1ccc2cnccc2c1)c1ccc2c(c1)NOB2O |
| InChI | InChI=1S/C19H18BN3O3/c21-10-16(14-3-4-17-18(9-14)23-26-20(17)25)19(24)8-12-1-2-15-11-22-6-5-13(15)7-12/h1-7,9,11,16,23,25H,8,10,21H2 |
| InChIKey | WNTSJOJXJUIJHL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|