C22H21BN4O3 — CID 167702705
(3S)-3-(2-acetyl-1-hydroxy-2,3,1-benzodiazaborinin-7-yl)-4-amino-1-isoquinolin-6-ylbutan-2-one (PubChem CID 167702705) has the molecular formula C22H21BN4O3 and a molecular weight of 400.25 g/mol. Its IUPAC name is (3S)-3-(2-acetyl-1-hydroxy-2,3,1-benzodiazaborinin-7-yl)-4-amino-1-isoquinolin-6-ylbutan-2-one.
| Compound Name | (3S)-3-(2-acetyl-1-hydroxy-2,3,1-benzodiazaborinin-7-yl)-4-amino-1-isoquinolin-6-ylbutan-2-one |
|---|---|
| PubChem CID | 167702705 |
| Molecular Formula | C22H21BN4O3 |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (3S)-3-(2-acetyl-1-hydroxy-2,3,1-benzodiazaborinin-7-yl)-4-amino-1-isoquinolin-6-ylbutan-2-one |
| SMILES | CC(=O)N1N=Cc2ccc([C@@H](CN)C(=O)Cc3ccc4cnccc4c3)cc2B1O |
| InChI | InChI=1S/C22H21BN4O3/c1-14(28)27-23(30)21-10-17(4-5-19(21)13-26-27)20(11-24)22(29)9-15-2-3-18-12-25-7-6-16(18)8-15/h2-8,10,12-13,20,30H,9,11,24H2,1H3/t20-/m1/s1 |
| InChIKey | VTWMQKWDHRIWPA-HXUWFJFHSA-N |
| XLogP | 0.97 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|