C20H19BN4O2 — CID 167666036
(3S)-4-amino-3-(1-hydroxy-2H-2,3,1-benzodiazaborinin-5-yl)-1-isoquinolin-6-ylbutan-2-one (PubChem CID 167666036) has the molecular formula C20H19BN4O2 and a molecular weight of 358.21 g/mol. Its IUPAC name is (3S)-4-amino-3-(1-hydroxy-2H-2,3,1-benzodiazaborinin-5-yl)-1-isoquinolin-6-ylbutan-2-one.
| Compound Name | (3S)-4-amino-3-(1-hydroxy-2H-2,3,1-benzodiazaborinin-5-yl)-1-isoquinolin-6-ylbutan-2-one |
|---|---|
| PubChem CID | 167666036 |
| Molecular Formula | C20H19BN4O2 |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (3S)-4-amino-3-(1-hydroxy-2H-2,3,1-benzodiazaborinin-5-yl)-1-isoquinolin-6-ylbutan-2-one |
| SMILES | NC[C@@H](C(=O)Cc1ccc2cnccc2c1)c1cccc2c1C=NNB2O |
| InChI | InChI=1S/C20H19BN4O2/c22-10-17(16-2-1-3-19-18(16)12-24-25-21(19)27)20(26)9-13-4-5-15-11-23-7-6-14(15)8-13/h1-8,11-12,17,25,27H,9-10,22H2/t17-/m1/s1 |
| InChIKey | JBIGIAQZQYLZMW-QGZVFWFLSA-N |
| XLogP | 0.71 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|