C23H26BN3O3 — CID 167554652
(3S)-4-amino-3-(2,2-dihydroxy-3,3-dimethyl-3-azonia-2-boranuidabicyclo[4.4.0]deca-1(6),4,7,9-tetraen-7-yl)-1-isoquinolin-6-ylbutan-2-one (PubChem CID 167554652) has the molecular formula C23H26BN3O3 and a molecular weight of 403.29 g/mol. Its IUPAC name is (3S)-4-amino-3-(2,2-dihydroxy-3,3-dimethyl-3-azonia-2-boranuidabicyclo[4.4.0]deca-1(6),4,7,9-tetraen-7-yl)-1-isoquinolin-6-ylbutan-2-one.
| Compound Name | (3S)-4-amino-3-(2,2-dihydroxy-3,3-dimethyl-3-azonia-2-boranuidabicyclo[4.4.0]deca-1(6),4,7,9-tetraen-7-yl)-1-isoquinolin-6-ylbutan-2-one |
|---|---|
| PubChem CID | 167554652 |
| Molecular Formula | C23H26BN3O3 |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (3S)-4-amino-3-(2,2-dihydroxy-3,3-dimethyl-3-azonia-2-boranuidabicyclo[4.4.0]deca-1(6),4,7,9-tetraen-7-yl)-1-isoquinolin-6-ylbutan-2-one |
| SMILES | C[N+]1(C)C=Cc2c([C@@H](CN)C(=O)Cc3ccc4cnccc4c3)cccc2[B-]1(O)O |
| InChI | InChI=1S/C23H26BN3O3/c1-27(2)11-9-20-19(4-3-5-22(20)24(27,29)30)21(14-25)23(28)13-16-6-7-18-15-26-10-8-17(18)12-16/h3-12,15,21,29-30H,13-14,25H2,1-2H3/t21-/m1/s1 |
| InChIKey | AZITVRVMOHLWSQ-OAQYLSRUSA-N |
| XLogP | 1.28 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|