C22H28BN3O3S — CID 167567504
[4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-[(dimethylamino)methyl]phenyl]boronic acid;sulfane (PubChem CID 167567504) has the molecular formula C22H28BN3O3S and a molecular weight of 425.36 g/mol. Its IUPAC name is [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-[(dimethylamino)methyl]phenyl]boronic acid;sulfane.
| Compound Name | [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-[(dimethylamino)methyl]phenyl]boronic acid;sulfane |
|---|---|
| PubChem CID | 167567504 |
| Molecular Formula | C22H28BN3O3S |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-[(dimethylamino)methyl]phenyl]boronic acid;sulfane |
| SMILES | CN(C)Cc1cc([C@@H](CN)C(=O)Cc2ccc3cnccc3c2)ccc1B(O)O.S |
| InChI | InChI=1S/C22H26BN3O3.H2S/c1-26(2)14-19-11-17(5-6-21(19)23(28)29)20(12-24)22(27)10-15-3-4-18-13-25-8-7-16(18)9-15;/h3-9,11,13,20,28-29H,10,12,14,24H2,1-2H3;1H2/t20-;/m1./s1 |
| InChIKey | FLYXRROZFAMLMW-VEIFNGETSA-N |
| XLogP | 0.94 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|