C21H22BN3O3S — CID 167559034
(3S)-4-amino-3-(1-hydroxy-3-methyl-2,4,1-benzoxazaborinin-6-yl)-1-isoquinolin-6-ylbutan-2-one;sulfane (PubChem CID 167559034) has the molecular formula C21H22BN3O3S and a molecular weight of 407.30 g/mol. Its IUPAC name is (3S)-4-amino-3-(1-hydroxy-3-methyl-2,4,1-benzoxazaborinin-6-yl)-1-isoquinolin-6-ylbutan-2-one;sulfane.
| Compound Name | (3S)-4-amino-3-(1-hydroxy-3-methyl-2,4,1-benzoxazaborinin-6-yl)-1-isoquinolin-6-ylbutan-2-one;sulfane |
|---|---|
| PubChem CID | 167559034 |
| Molecular Formula | C21H22BN3O3S |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (3S)-4-amino-3-(1-hydroxy-3-methyl-2,4,1-benzoxazaborinin-6-yl)-1-isoquinolin-6-ylbutan-2-one;sulfane |
| SMILES | CC1=Nc2cc([C@@H](CN)C(=O)Cc3ccc4cnccc4c3)ccc2B(O)O1.S |
| InChI | InChI=1S/C21H20BN3O3.H2S/c1-13-25-20-10-16(4-5-19(20)22(27)28-13)18(11-23)21(26)9-14-2-3-17-12-24-7-6-15(17)8-14;/h2-8,10,12,18,27H,9,11,23H2,1H3;1H2/t18-;/m1./s1 |
| InChIKey | DJZABIOYTMYVJP-GMUIIQOCSA-N |
| XLogP | 1.97 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|