C22H23BN2O3S — CID 167544867
2-[4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]phenyl]oxaborolan-5-one;sulfane (PubChem CID 167544867) has the molecular formula C22H23BN2O3S and a molecular weight of 406.32 g/mol. Its IUPAC name is 2-[4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]phenyl]oxaborolan-5-one;sulfane.
| Compound Name | 2-[4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]phenyl]oxaborolan-5-one;sulfane |
|---|---|
| PubChem CID | 167544867 |
| Molecular Formula | C22H23BN2O3S |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-[4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]phenyl]oxaborolan-5-one;sulfane |
| SMILES | NC[C@@H](C(=O)Cc1ccc2cnccc2c1)c1ccc(B2CCC(=O)O2)cc1.S |
| InChI | InChI=1S/C22H21BN2O3.H2S/c24-13-20(16-3-5-19(6-4-16)23-9-7-22(27)28-23)21(26)12-15-1-2-18-14-25-10-8-17(18)11-15;/h1-6,8,10-11,14,20H,7,9,12-13,24H2;1H2/t20-;/m1./s1 |
| InChIKey | BQTZZRBANRXTJO-VEIFNGETSA-N |
| XLogP | 2.35 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|