C21H21BN4O3 — CID 167660511
7-(1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl)-1-hydroxy-2-methyl-4H-2,4,1-benzodiazaborinin-3-one (PubChem CID 167660511) has the molecular formula C21H21BN4O3 and a molecular weight of 388.24 g/mol. Its IUPAC name is 7-(1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl)-1-hydroxy-2-methyl-4H-2,4,1-benzodiazaborinin-3-one.
| Compound Name | 7-(1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl)-1-hydroxy-2-methyl-4H-2,4,1-benzodiazaborinin-3-one |
|---|---|
| PubChem CID | 167660511 |
| Molecular Formula | C21H21BN4O3 |
| Molecular Weight | 388.24 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 7-(1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl)-1-hydroxy-2-methyl-4H-2,4,1-benzodiazaborinin-3-one |
| SMILES | CN1B(O)c2cc(C(CN)C(=O)Cc3ccc4cnccc4c3)ccc2NC1=O |
| InChI | InChI=1S/C21H21BN4O3/c1-26-21(28)25-19-5-4-15(10-18(19)22(26)29)17(11-23)20(27)9-13-2-3-16-12-24-7-6-14(16)8-13/h2-8,10,12,17,29H,9,11,23H2,1H3,(H,25,28) |
| InChIKey | RWUNSWVOBKLAOJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|