C26H23BN4O2 — CID 167701197
4-amino-3-(1-hydroxy-2-phenyl-2,3,1-benzodiazaborinin-6-yl)-1-isoquinolin-6-ylbutan-2-one (PubChem CID 167701197) has the molecular formula C26H23BN4O2 and a molecular weight of 434.31 g/mol. Its IUPAC name is 4-amino-3-(1-hydroxy-2-phenyl-2,3,1-benzodiazaborinin-6-yl)-1-isoquinolin-6-ylbutan-2-one.
| Compound Name | 4-amino-3-(1-hydroxy-2-phenyl-2,3,1-benzodiazaborinin-6-yl)-1-isoquinolin-6-ylbutan-2-one |
|---|---|
| PubChem CID | 167701197 |
| Molecular Formula | C26H23BN4O2 |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 4-amino-3-(1-hydroxy-2-phenyl-2,3,1-benzodiazaborinin-6-yl)-1-isoquinolin-6-ylbutan-2-one |
| SMILES | NCC(C(=O)Cc1ccc2cnccc2c1)c1ccc2c(c1)C=NN(c1ccccc1)B2O |
| InChI | InChI=1S/C26H23BN4O2/c28-15-24(26(32)13-18-6-7-21-16-29-11-10-19(21)12-18)20-8-9-25-22(14-20)17-30-31(27(25)33)23-4-2-1-3-5-23/h1-12,14,16-17,24,33H,13,15,28H2 |
| InChIKey | YKJXTLRVFBRKOU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|