About [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane
[4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane (PubChem CID 167561297) has the molecular formula C20H23BN2O3S
and a molecular weight of 382.29 g/mol. Its IUPAC name is [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane.
Molecular Properties
| Compound Name | [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane |
| PubChem CID | 167561297 |
| Molecular Formula | C20H23BN2O3S |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane |
| SMILES | Cc1cc([C@@H](CN)C(=O)Cc2ccc3cnccc3c2)ccc1B(O)O.S |
| InChI | InChI=1S/C20H21BN2O3.H2S/c1-13-8-16(4-5-19(13)21(25)26)18(11-22)20(24)10-14-2-3-17-12-23-7-6-15(17)9-14;/h2-9,12,18,25-26H,10-11,22H2,1H3;1H2/t18-;/m1./s1 |
| InChIKey | DRQMUULTEOALCR-GMUIIQOCSA-N |
| XLogP | 1.19 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane?
The IUPAC name of [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane (CID 167561297) is [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane.
What is the SMILES notation for [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane?
The canonical SMILES for [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane is Cc1cc([C@@H](CN)C(=O)Cc2ccc3cnccc3c2)ccc1B(O)O.S.
What is the InChIKey of [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane?
The InChIKey is DRQMUULTEOALCR-GMUIIQOCSA-N. The full InChI is InChI=1S/C20H21BN2O3.H2S/c1-13-8-16(4-5-19(13)21(25)26)18(11-22)20(24)10-14-2-3-17-12-23-7-6-15(17)9-14;/h2-9,12,18,25-26H,10-11,22H2,1H3;1H2/t18-;/m1./s1.
What are the key properties of [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane?
[4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane has a molecular weight of 382.29 g/mol, XLogP of 1.19, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane is sourced from PubChem (CID 167561297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).