C20H23BN2O3S — CID 167561297
[4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane (PubChem CID 167561297) has the molecular formula C20H23BN2O3S and a molecular weight of 382.29 g/mol. Its IUPAC name is [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane.
| Compound Name | [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane |
|---|---|
| PubChem CID | 167561297 |
| Molecular Formula | C20H23BN2O3S |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [4-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-2-methylphenyl]boronic acid;sulfane |
| SMILES | Cc1cc([C@@H](CN)C(=O)Cc2ccc3cnccc3c2)ccc1B(O)O.S |
| InChI | InChI=1S/C20H21BN2O3.H2S/c1-13-8-16(4-5-19(13)21(25)26)18(11-22)20(24)10-14-2-3-17-12-23-7-6-15(17)9-14;/h2-9,12,18,25-26H,10-11,22H2,1H3;1H2/t18-;/m1./s1 |
| InChIKey | DRQMUULTEOALCR-GMUIIQOCSA-N |
| XLogP | 1.19 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|