C20H18BN3O4 — CID 167651402
5-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-1-hydroxy-2,3,1-benzoxazaborinin-4-one (PubChem CID 167651402) has the molecular formula C20H18BN3O4 and a molecular weight of 375.19 g/mol. Its IUPAC name is 5-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-1-hydroxy-2,3,1-benzoxazaborinin-4-one.
| Compound Name | 5-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-1-hydroxy-2,3,1-benzoxazaborinin-4-one |
|---|---|
| PubChem CID | 167651402 |
| Molecular Formula | C20H18BN3O4 |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 5-[(2S)-1-amino-4-isoquinolin-6-yl-3-oxobutan-2-yl]-1-hydroxy-2,3,1-benzoxazaborinin-4-one |
| SMILES | NC[C@@H](C(=O)Cc1ccc2cnccc2c1)c1cccc2c1C(=O)NOB2O |
| InChI | InChI=1S/C20H18BN3O4/c22-10-16(15-2-1-3-17-19(15)20(26)24-28-21(17)27)18(25)9-12-4-5-14-11-23-7-6-13(14)8-12/h1-8,11,16,27H,9-10,22H2,(H,24,26)/t16-/m1/s1 |
| InChIKey | ZQALWDXGRDRDAQ-MRXNPFEDSA-N |
| XLogP | 0.45 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|