C20H18BFN2O3 — CID 167580804
4-amino-3-(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-isoquinolin-6-ylbutan-2-one (PubChem CID 167580804) has the molecular formula C20H18BFN2O3 and a molecular weight of 364.19 g/mol. Its IUPAC name is 4-amino-3-(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-isoquinolin-6-ylbutan-2-one.
| Compound Name | 4-amino-3-(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-isoquinolin-6-ylbutan-2-one |
|---|---|
| PubChem CID | 167580804 |
| Molecular Formula | C20H18BFN2O3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 4-amino-3-(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-isoquinolin-6-ylbutan-2-one |
| SMILES | NCC(C(=O)Cc1ccc2cnccc2c1)c1ccc2c(c1F)B(O)OC2 |
| InChI | InChI=1S/C20H18BFN2O3/c22-20-16(4-3-15-11-27-21(26)19(15)20)17(9-23)18(25)8-12-1-2-14-10-24-6-5-13(14)7-12/h1-7,10,17,26H,8-9,11,23H2 |
| InChIKey | HDSKOUQEHJZPBO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|