C21H25BN4O3 — CID 174027265
[3-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]-2-[(dimethylamino)methyl]phenyl]boronic acid (PubChem CID 174027265) has the molecular formula C21H25BN4O3 and a molecular weight of 392.27 g/mol. Its IUPAC name is [3-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]-2-[(dimethylamino)methyl]phenyl]boronic acid.
| Compound Name | [3-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]-2-[(dimethylamino)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 174027265 |
| Molecular Formula | C21H25BN4O3 |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | [3-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]-2-[(dimethylamino)methyl]phenyl]boronic acid |
| SMILES | CN(C)Cc1c(B(O)O)cccc1C(CN)C(=O)Nc1ccc2cnccc2c1 |
| InChI | InChI=1S/C21H25BN4O3/c1-26(2)13-19-17(4-3-5-20(19)22(28)29)18(11-23)21(27)25-16-7-6-15-12-24-9-8-14(15)10-16/h3-10,12,18,28-29H,11,13,23H2,1-2H3,(H,25,27) |
| InChIKey | WTPPXYRPCINNGP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|