C20H22BN3O3 — CID 174027273
[3-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]-2-methylphenyl]methylboronic acid (PubChem CID 174027273) has the molecular formula C20H22BN3O3 and a molecular weight of 363.23 g/mol. Its IUPAC name is [3-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]-2-methylphenyl]methylboronic acid.
| Compound Name | [3-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]-2-methylphenyl]methylboronic acid |
|---|---|
| PubChem CID | 174027273 |
| Molecular Formula | C20H22BN3O3 |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [3-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]-2-methylphenyl]methylboronic acid |
| SMILES | Cc1c(CB(O)O)cccc1C(CN)C(=O)Nc1ccc2cnccc2c1 |
| InChI | InChI=1S/C20H22BN3O3/c1-13-15(10-21(26)27)3-2-4-18(13)19(11-22)20(25)24-17-6-5-16-12-23-8-7-14(16)9-17/h2-9,12,19,26-27H,10-11,22H2,1H3,(H,24,25) |
| InChIKey | UMLITHYHOPVMCG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|