C19H22N6 — CID 59564767
4-(5-methyl-1H-pyrazol-4-yl)-N-(1-phenylpiperidin-4-yl)pyrimidin-2-amine (PubChem CID 59564767) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is 4-(5-methyl-1H-pyrazol-4-yl)-N-(1-phenylpiperidin-4-yl)pyrimidin-2-amine.
| Compound Name | 4-(5-methyl-1H-pyrazol-4-yl)-N-(1-phenylpiperidin-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 59564767 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-(5-methyl-1H-pyrazol-4-yl)-N-(1-phenylpiperidin-4-yl)pyrimidin-2-amine |
| SMILES | Cc1[nH]ncc1-c1ccnc(NC2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C19H22N6/c1-14-17(13-21-24-14)18-7-10-20-19(23-18)22-15-8-11-25(12-9-15)16-5-3-2-4-6-16/h2-7,10,13,15H,8-9,11-12H2,1H3,(H,21,24)(H,20,22,23) |
| InChIKey | IISASVFZUNKYAN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |