C23H26N2O3S — CID 59565300
2-[3-(3-methoxyprop-1-ynyl)-8-methylquinolin-6-yl]oxy-N-(2-methylpent-3-yn-2-yl)-2-methylsulfanylacetamide (PubChem CID 59565300) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-[3-(3-methoxyprop-1-ynyl)-8-methylquinolin-6-yl]oxy-N-(2-methylpent-3-yn-2-yl)-2-methylsulfanylacetamide.
| Compound Name | 2-[3-(3-methoxyprop-1-ynyl)-8-methylquinolin-6-yl]oxy-N-(2-methylpent-3-yn-2-yl)-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 59565300 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[3-(3-methoxyprop-1-ynyl)-8-methylquinolin-6-yl]oxy-N-(2-methylpent-3-yn-2-yl)-2-methylsulfanylacetamide |
| SMILES | CC#CC(C)(C)NC(=O)C(Oc1cc(C)c2ncc(C#CCOC)cc2c1)SC |
| InChI | InChI=1S/C23H26N2O3S/c1-7-10-23(3,4)25-21(26)22(29-6)28-19-12-16(2)20-18(14-19)13-17(15-24-20)9-8-11-27-5/h12-15,22H,11H2,1-6H3,(H,25,26) |
| InChIKey | RYBFFUSJOSDBFC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|