C17H32O2 — CID 59566099
(4R)-6-[(3S,5S)-3,5-dimethyloct-7-enoxy]-4-methylhexan-2-one (PubChem CID 59566099) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (4R)-6-[(3S,5S)-3,5-dimethyloct-7-enoxy]-4-methylhexan-2-one.
| Compound Name | (4R)-6-[(3S,5S)-3,5-dimethyloct-7-enoxy]-4-methylhexan-2-one |
|---|---|
| PubChem CID | 59566099 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (4R)-6-[(3S,5S)-3,5-dimethyloct-7-enoxy]-4-methylhexan-2-one |
| SMILES | C=CC[C@H](C)C[C@H](C)CCOCC[C@@H](C)CC(C)=O |
| InChI | InChI=1S/C17H32O2/c1-6-7-14(2)12-15(3)8-10-19-11-9-16(4)13-17(5)18/h6,14-16H,1,7-13H2,2-5H3/t14-,15+,16+/m0/s1 |
| InChIKey | ZPCNSRZXZBALTP-ARFHVFGLSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|