C23H42O3 — CID 139549646
7-(methoxymethyl)henicos-1-ene-5,10-dione (PubChem CID 139549646) has the molecular formula C23H42O3 and a molecular weight of 366.59 g/mol. Its IUPAC name is 7-(methoxymethyl)henicos-1-ene-5,10-dione.
| Compound Name | 7-(methoxymethyl)henicos-1-ene-5,10-dione |
|---|---|
| PubChem CID | 139549646 |
| Molecular Formula | C23H42O3 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | 7-(methoxymethyl)henicos-1-ene-5,10-dione |
| SMILES | C=CCCC(=O)CC(CCC(=O)CCCCCCCCCCC)COC |
| InChI | InChI=1S/C23H42O3/c1-4-6-8-9-10-11-12-13-14-16-22(24)18-17-21(20-26-3)19-23(25)15-7-5-2/h5,21H,2,4,6-20H2,1,3H3 |
| InChIKey | WJXIUWORZORTQO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|