C34H41N5O3S — CID 59569650
3-N-[(2S,3R)-4-[(2,6-dimethyl-5-propan-2-yl-3-pyridinyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-1-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide (PubChem CID 59569650) has the molecular formula C34H41N5O3S and a molecular weight of 599.80 g/mol. Its IUPAC name is 3-N-[(2S,3R)-4-[(2,6-dimethyl-5-propan-2-yl-3-pyridinyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-1-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-[(2S,3R)-4-[(2,6-dimethyl-5-propan-2-yl-3-pyridinyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-1-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 59569650 |
| Molecular Formula | C34H41N5O3S |
| Molecular Weight | 599.80 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | 3-N-[(2S,3R)-4-[(2,6-dimethyl-5-propan-2-yl-3-pyridinyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-1-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide |
| SMILES | Cc1csc(CNC(=O)c2cccc(C(=O)N[C@@H](Cc3ccccc3)[C@H](O)CNCc3cc(C(C)C)c(C)nc3C)c2)n1 |
| InChI | InChI=1S/C34H41N5O3S/c1-21(2)29-16-28(23(4)38-24(29)5)17-35-18-31(40)30(14-25-10-7-6-8-11-25)39-34(42)27-13-9-12-26(15-27)33(41)36-19-32-37-22(3)20-43-32/h6-13,15-16,20-21,30-31,35,40H,14,17-19H2,1-5H3,(H,36,41)(H,39,42)/t30-,31+/m0/s1 |
| InChIKey | GRIZKASAQFQUMC-IOWSJCHKSA-N |
| XLogP | 5.01 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.80 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |