C22H31NO — CID 59570704
3-[benzyl(propan-2-yl)amino]-1-(2,4,6-trimethylphenyl)propan-1-ol (PubChem CID 59570704) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 3-[benzyl(propan-2-yl)amino]-1-(2,4,6-trimethylphenyl)propan-1-ol.
| Compound Name | 3-[benzyl(propan-2-yl)amino]-1-(2,4,6-trimethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 59570704 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 3-[benzyl(propan-2-yl)amino]-1-(2,4,6-trimethylphenyl)propan-1-ol |
| SMILES | Cc1cc(C)c(C(O)CCN(Cc2ccccc2)C(C)C)c(C)c1 |
| InChI | InChI=1S/C22H31NO/c1-16(2)23(15-20-9-7-6-8-10-20)12-11-21(24)22-18(4)13-17(3)14-19(22)5/h6-10,13-14,16,21,24H,11-12,15H2,1-5H3 |
| InChIKey | VSIMBNDIKCRGJH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |