C51H41N5O3 — CID 59572146
N-[4-(2-cyclohexylethynyl)phenyl]-3,4-bis[[4-(2-phenylethynyl)phenyl]carbamoylamino]benzamide (PubChem CID 59572146) has the molecular formula C51H41N5O3 and a molecular weight of 771.92 g/mol. Its IUPAC name is N-[4-(2-cyclohexylethynyl)phenyl]-3,4-bis[[4-(2-phenylethynyl)phenyl]carbamoylamino]benzamide.
| Compound Name | N-[4-(2-cyclohexylethynyl)phenyl]-3,4-bis[[4-(2-phenylethynyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 59572146 |
| Molecular Formula | C51H41N5O3 |
| Molecular Weight | 771.92 g/mol |
| Exact Mass | 771.32 |
| IUPAC Name | N-[4-(2-cyclohexylethynyl)phenyl]-3,4-bis[[4-(2-phenylethynyl)phenyl]carbamoylamino]benzamide |
| SMILES | O=C(Nc1ccc(C#Cc2ccccc2)cc1)Nc1ccc(C(=O)Nc2ccc(C#CC3CCCCC3)cc2)cc1NC(=O)Nc1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C51H41N5O3/c57-49(52-44-29-22-40(23-30-44)19-16-37-10-4-1-5-11-37)43-28-35-47(55-50(58)53-45-31-24-41(25-32-45)20-17-38-12-6-2-7-13-38)48(36-43)56-51(59)54-46-33-26-42(27-34-46)21-18-39-14-8-3-9-15-39/h2-3,6-9,12-15,22-37H,1,4-5,10-11H2,(H,52,57)(H2,53,55,58)(H2,54,56,59) |
| InChIKey | MHAXITPWZOCHJV-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.92 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|