C23H25N3O — CID 59572362
9-(4-tert-butyl-2,6-dimethylphenyl)-6-methyl-2-oxa-5,9,13-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene (PubChem CID 59572362) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 9-(4-tert-butyl-2,6-dimethylphenyl)-6-methyl-2-oxa-5,9,13-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene.
| Compound Name | 9-(4-tert-butyl-2,6-dimethylphenyl)-6-methyl-2-oxa-5,9,13-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
|---|---|
| PubChem CID | 59572362 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 9-(4-tert-butyl-2,6-dimethylphenyl)-6-methyl-2-oxa-5,9,13-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
| SMILES | Cc1cc2c(cn1)Oc1cnccc1N2c1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C23H25N3O/c1-14-9-17(23(4,5)6)10-15(2)22(14)26-18-7-8-24-12-20(18)27-21-13-25-16(3)11-19(21)26/h7-13H,1-6H3 |
| InChIKey | OPFQOVWOOYBYQK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |