C18H27N5O2 — CID 59575770
tert-butyl 2,2,3,4-tetradeuterio-3-[(2-deuterio-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-(trideuteriomethyl)amino]-4-(trideuteriomethyl)piperidine-1-carboxylate (PubChem CID 59575770) has the molecular formula C18H27N5O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is tert-butyl 2,2,3,4-tetradeuterio-3-[(2-deuterio-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-(trideuteriomethyl)amino]-4-(trideuteriomethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2,2,3,4-tetradeuterio-3-[(2-deuterio-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-(trideuteriomethyl)amino]-4-(trideuteriomethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59575770 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | tert-butyl 2,2,3,4-tetradeuterio-3-[(2-deuterio-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-(trideuteriomethyl)amino]-4-(trideuteriomethyl)piperidine-1-carboxylate |
| SMILES | [2H]c1nc(N(C([2H])([2H])[2H])C2([2H])C([2H])([2H])N(C(=O)OC(C)(C)C)CCC2([2H])C([2H])([2H])[2H])c2cc[nH]c2n1 |
| InChI | InChI=1S/C18H27N5O2/c1-12-7-9-23(17(24)25-18(2,3)4)10-14(12)22(5)16-13-6-8-19-15(13)20-11-21-16/h6,8,11-12,14H,7,9-10H2,1-5H3,(H,19,20,21)/i1D3,5D3,10D2,11D,12D,14D |
| InChIKey | MNUYILMTXWFWMH-NUACFLQZSA-N |
| XLogP | 3.04 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |