C19H24N6O — CID 59579828
N-(1-adamantylmethyl)-3-amino-1-pyrimidin-2-ylpyrazole-4-carboxamide (PubChem CID 59579828) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-3-amino-1-pyrimidin-2-ylpyrazole-4-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-3-amino-1-pyrimidin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 59579828 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N-(1-adamantylmethyl)-3-amino-1-pyrimidin-2-ylpyrazole-4-carboxamide |
| SMILES | Nc1nn(-c2ncccn2)cc1C(=O)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H24N6O/c20-16-15(10-25(24-16)18-21-2-1-3-22-18)17(26)23-11-19-7-12-4-13(8-19)6-14(5-12)9-19/h1-3,10,12-14H,4-9,11H2,(H2,20,24)(H,23,26) |
| InChIKey | LJVXHORYIDBTOX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |