C21H24F3N5O — CID 59579870
N-(1-adamantylmethyl)-1-(3-amino-2-pyridinyl)-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 59579870) has the molecular formula C21H24F3N5O and a molecular weight of 419.45 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-1-(3-amino-2-pyridinyl)-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-1-(3-amino-2-pyridinyl)-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 59579870 |
| Molecular Formula | C21H24F3N5O |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-(1-adamantylmethyl)-1-(3-amino-2-pyridinyl)-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Nc1cccnc1-n1cc(C(=O)NCC23CC4CC(CC(C4)C2)C3)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C21H24F3N5O/c22-21(23,24)17-15(10-29(28-17)18-16(25)2-1-3-26-18)19(30)27-11-20-7-12-4-13(8-20)6-14(5-12)9-20/h1-3,10,12-14H,4-9,11,25H2,(H,27,30) |
| InChIKey | SULATALIJVPMFH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |