C33H48N3O5+ — CID 59582342
6-[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]amino]propanoyloxy]hexyl-trimethylazanium (PubChem CID 59582342) has the molecular formula C33H48N3O5+ and a molecular weight of 566.76 g/mol. Its IUPAC name is 6-[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]amino]propanoyloxy]hexyl-trimethylazanium.
| Compound Name | 6-[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]amino]propanoyloxy]hexyl-trimethylazanium |
|---|---|
| PubChem CID | 59582342 |
| Molecular Formula | C33H48N3O5+ |
| Molecular Weight | 566.76 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | 6-[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]amino]propanoyloxy]hexyl-trimethylazanium |
| SMILES | CC(C)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC(C)C(=O)OCCCCCC[N+](C)(C)C |
| InChI | InChI=1S/C33H47N3O5/c1-23(2)21-30(31(37)34-24(3)32(38)40-20-14-8-7-13-19-36(4,5)6)35-33(39)41-22-29-27-17-11-9-15-25(27)26-16-10-12-18-28(26)29/h9-12,15-18,23-24,29-30H,7-8,13-14,19-22H2,1-6H3,(H-,34,35,37,39)/p+1 |
| InChIKey | GELOMCGXSOAOMS-UHFFFAOYSA-O |
| XLogP | 5.25 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.76 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|