C26H24ClFN4O2 — CID 59585412
N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide (PubChem CID 59585412) has the molecular formula C26H24ClFN4O2 and a molecular weight of 478.96 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 59585412 |
| Molecular Formula | C26H24ClFN4O2 |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2ccccc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N1CCCCC1 |
| InChI | InChI=1S/C26H24ClFN4O2/c27-19-9-11-24(30-16-19)31-26(34)20-7-3-2-6-17(20)15-23(33)21-10-8-18(14-22(21)28)25(29)32-12-4-1-5-13-32/h2-3,6-11,14,16,29H,1,4-5,12-13,15H2,(H,30,31,34)/b29-25- |
| InChIKey | SVLCPXJTEYYXTN-GNVQSUKOSA-N |
| XLogP | 5.36 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|