C25H22ClFN4O2 — CID 59585446
N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide (PubChem CID 59585446) has the molecular formula C25H22ClFN4O2 and a molecular weight of 464.93 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 59585446 |
| Molecular Formula | C25H22ClFN4O2 |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2ccccc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N1CCCC1 |
| InChI | InChI=1S/C25H22ClFN4O2/c26-18-8-10-23(29-15-18)30-25(33)19-6-2-1-5-16(19)14-22(32)20-9-7-17(13-21(20)27)24(28)31-11-3-4-12-31/h1-2,5-10,13,15,28H,3-4,11-12,14H2,(H,29,30,33)/b28-24- |
| InChIKey | RKJUBILVYPGYOR-COOPMVRXSA-N |
| XLogP | 4.97 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|