C25H26N4O3 — CID 59589792
2-[4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 59589792) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 59589792 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 2-[4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1ccc(Cc2nc3cccc(-c4ccc5c(c4)OCCO5)n3n2)cc1 |
| InChI | InChI=1S/C25H26N4O3/c1-28(2)12-13-30-20-9-6-18(7-10-20)16-24-26-25-5-3-4-21(29(25)27-24)19-8-11-22-23(17-19)32-15-14-31-22/h3-11,17H,12-16H2,1-2H3 |
| InChIKey | NFDZGGRGLJRNLG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 61.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |