C26H28N4O2 — CID 59590060
3-[4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenyl]-N,N-dimethylpropan-1-amine (PubChem CID 59590060) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 3-[4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenyl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenyl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 59590060 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 3-[4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenyl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1ccc(Cc2nc3cccc(-c4ccc5c(c4)OCCO5)n3n2)cc1 |
| InChI | InChI=1S/C26H28N4O2/c1-29(2)14-4-5-19-8-10-20(11-9-19)17-25-27-26-7-3-6-22(30(26)28-25)21-12-13-23-24(18-21)32-16-15-31-23/h3,6-13,18H,4-5,14-17H2,1-2H3 |
| InChIKey | QIYGQNXTGKZPPJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 51.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |