C28H32FN5O4 — CID 59590294
(5R,7S)-1-(3-fluorophenyl)-7-methyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-8-[(3-propan-2-yloxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 59590294) has the molecular formula C28H32FN5O4 and a molecular weight of 521.59 g/mol. Its IUPAC name is (5R,7S)-1-(3-fluorophenyl)-7-methyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-8-[(3-propan-2-yloxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,7S)-1-(3-fluorophenyl)-7-methyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-8-[(3-propan-2-yloxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 59590294 |
| Molecular Formula | C28H32FN5O4 |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | (5R,7S)-1-(3-fluorophenyl)-7-methyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-8-[(3-propan-2-yloxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1nc(CN2C(=O)N(c3cccc(F)c3)[C@@]3(CCN(Cc4cccc(OC(C)C)c4)[C@@H](C)C3)C2=O)no1 |
| InChI | InChI=1S/C28H32FN5O4/c1-18(2)37-24-10-5-7-21(13-24)16-32-12-11-28(15-19(32)3)26(35)33(17-25-30-20(4)38-31-25)27(36)34(28)23-9-6-8-22(29)14-23/h5-10,13-14,18-19H,11-12,15-17H2,1-4H3/t19-,28+/m0/s1 |
| InChIKey | ALELXIVTZGDACJ-HMILPKGGSA-N |
| XLogP | 4.70 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|