C7H5N3O2 — CID 595909
1H-pyrido[3,2-d]pyrimidine-2,4-dione (PubChem CID 595909) has the molecular formula C7H5N3O2 and a molecular weight of 163.14 g/mol. Its IUPAC name is 1H-pyrido[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 1H-pyrido[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 595909 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 1H-pyrido[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2ncccc2[nH]1 |
| InChI | InChI=1S/C7H5N3O2/c11-6-5-4(2-1-3-8-5)9-7(12)10-6/h1-3H,(H2,9,10,11,12) |
| InChIKey | BJLUORNGPCXNHM-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |