C29H32F2 — CID 59592220
3,4-difluoro-1-methyl-5-(4-pentylphenyl)-2-[(E)-2-(4-propylphenyl)ethenyl]benzene (PubChem CID 59592220) has the molecular formula C29H32F2 and a molecular weight of 418.57 g/mol. Its IUPAC name is 3,4-difluoro-1-methyl-5-(4-pentylphenyl)-2-[(E)-2-(4-propylphenyl)ethenyl]benzene.
| Compound Name | 3,4-difluoro-1-methyl-5-(4-pentylphenyl)-2-[(E)-2-(4-propylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 59592220 |
| Molecular Formula | C29H32F2 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 3,4-difluoro-1-methyl-5-(4-pentylphenyl)-2-[(E)-2-(4-propylphenyl)ethenyl]benzene |
| SMILES | CCCCCc1ccc(-c2cc(C)c(/C=C/c3ccc(CCC)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C29H32F2/c1-4-6-7-9-23-14-17-25(18-15-23)27-20-21(3)26(28(30)29(27)31)19-16-24-12-10-22(8-5-2)11-13-24/h10-20H,4-9H2,1-3H3/b19-16+ |
| InChIKey | UOODEWYLADFUDO-KNTRCKAVSA-N |
| XLogP | 8.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|