C30H36 — CID 54225098
5-butan-2-yl-2-[2-[4-(4-butylphenyl)phenyl]ethenyl]-1,3-dimethylbenzene (PubChem CID 54225098) has the molecular formula C30H36 and a molecular weight of 396.62 g/mol. Its IUPAC name is 5-butan-2-yl-2-[2-[4-(4-butylphenyl)phenyl]ethenyl]-1,3-dimethylbenzene.
| Compound Name | 5-butan-2-yl-2-[2-[4-(4-butylphenyl)phenyl]ethenyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 54225098 |
| Molecular Formula | C30H36 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 5-butan-2-yl-2-[2-[4-(4-butylphenyl)phenyl]ethenyl]-1,3-dimethylbenzene |
| SMILES | CCCCc1ccc(-c2ccc(C=Cc3c(C)cc(C(C)CC)cc3C)cc2)cc1 |
| InChI | InChI=1S/C30H36/c1-6-8-9-25-10-15-27(16-11-25)28-17-12-26(13-18-28)14-19-30-23(4)20-29(21-24(30)5)22(3)7-2/h10-22H,6-9H2,1-5H3 |
| InChIKey | QFHIFLJASDMCJX-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|