C20H26 — CID 123139231
1-butan-2-yl-4-[3-(3-methylphenyl)propyl]benzene (PubChem CID 123139231) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-butan-2-yl-4-[3-(3-methylphenyl)propyl]benzene.
| Compound Name | 1-butan-2-yl-4-[3-(3-methylphenyl)propyl]benzene |
|---|---|
| PubChem CID | 123139231 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 1-butan-2-yl-4-[3-(3-methylphenyl)propyl]benzene |
| SMILES | CCC(C)c1ccc(CCCc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C20H26/c1-4-17(3)20-13-11-18(12-14-20)8-6-10-19-9-5-7-16(2)15-19/h5,7,9,11-15,17H,4,6,8,10H2,1-3H3 |
| InChIKey | PNALICXUCRWHSG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |